C9H17F4NO3 — CID 106291988
1-(2-methoxyethoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol (PubChem CID 106291988) has the molecular formula C9H17F4NO3 and a molecular weight of 263.23 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol.
| Compound Name | 1-(2-methoxyethoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 106291988 |
| Molecular Formula | C9H17F4NO3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(2-methoxyethoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
| SMILES | COCCOCC(O)CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H17F4NO3/c1-16-2-3-17-5-7(15)4-14-6-9(12,13)8(10)11/h7-8,14-15H,2-6H2,1H3 |
| InChIKey | VLRPZFPLOCDQNX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|