C13H23F4NO2 — CID 106291617
1-(4-methylcyclohexyl)oxy-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol (PubChem CID 106291617) has the molecular formula C13H23F4NO2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)oxy-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol.
| Compound Name | 1-(4-methylcyclohexyl)oxy-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 106291617 |
| Molecular Formula | C13H23F4NO2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-(4-methylcyclohexyl)oxy-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
| SMILES | CC1CCC(OCC(O)CNCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C13H23F4NO2/c1-9-2-4-11(5-3-9)20-7-10(19)6-18-8-13(16,17)12(14)15/h9-12,18-19H,2-8H2,1H3 |
| InChIKey | JRZJXDZEQZKFJL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|