C15H31NO4S — CID 79562330
1-(4-methylcyclohexyl)oxy-3-[(2-methyl-2-methylsulfonylpropyl)amino]propan-2-ol (PubChem CID 79562330) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)oxy-3-[(2-methyl-2-methylsulfonylpropyl)amino]propan-2-ol.
| Compound Name | 1-(4-methylcyclohexyl)oxy-3-[(2-methyl-2-methylsulfonylpropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 79562330 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-(4-methylcyclohexyl)oxy-3-[(2-methyl-2-methylsulfonylpropyl)amino]propan-2-ol |
| SMILES | CC1CCC(OCC(O)CNCC(C)(C)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H31NO4S/c1-12-5-7-14(8-6-12)20-10-13(17)9-16-11-15(2,3)21(4,18)19/h12-14,16-17H,5-11H2,1-4H3 |
| InChIKey | ZJNZKSWPYTXXID-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |