C13H26N2O4 — CID 106255019
2-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-N-(oxan-4-yl)acetamide (PubChem CID 106255019) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 106255019 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-N-(oxan-4-yl)acetamide |
| SMILES | COCCC(C)(O)CNCC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C13H26N2O4/c1-13(17,5-8-18-2)10-14-9-12(16)15-11-3-6-19-7-4-11/h11,14,17H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | FGSBATHRPCMTMS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |