C7H14Cl2N2 — CID 79167152
N-(2,3-dichloroprop-2-enyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 79167152) has the molecular formula C7H14Cl2N2 and a molecular weight of 197.11 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 79167152 |
| Molecular Formula | C7H14Cl2N2 |
| Molecular Weight | 197.11 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC(Cl)=CCl |
| InChI | InChI=1S/C7H14Cl2N2/c1-11(2)4-3-10-6-7(9)5-8/h5,10H,3-4,6H2,1-2H3 |
| InChIKey | KXFRSRZYXHHQPK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|