C9H15Cl2NO — CID 106401566
(E)-N-(2-but-3-enoxyethyl)-2,3-dichloroprop-2-en-1-amine (PubChem CID 106401566) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is (E)-N-(2-but-3-enoxyethyl)-2,3-dichloroprop-2-en-1-amine.
| Compound Name | (E)-N-(2-but-3-enoxyethyl)-2,3-dichloroprop-2-en-1-amine |
|---|---|
| PubChem CID | 106401566 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (E)-N-(2-but-3-enoxyethyl)-2,3-dichloroprop-2-en-1-amine |
| SMILES | C=CCCOCCNC/C(Cl)=C\Cl |
| InChI | InChI=1S/C9H15Cl2NO/c1-2-3-5-13-6-4-12-8-9(11)7-10/h2,7,12H,1,3-6,8H2/b9-7+ |
| InChIKey | CARNKLMRLZTSQN-VQHVLOKHSA-N |
| XLogP | 2.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|