C9H18Cl2N2O2S — CID 79168502
N-[3-(2,3-dichloroprop-2-enylamino)propyl]-N-ethylmethanesulfonamide (PubChem CID 79168502) has the molecular formula C9H18Cl2N2O2S and a molecular weight of 289.23 g/mol. Its IUPAC name is N-[3-(2,3-dichloroprop-2-enylamino)propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-(2,3-dichloroprop-2-enylamino)propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 79168502 |
| Molecular Formula | C9H18Cl2N2O2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[3-(2,3-dichloroprop-2-enylamino)propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNCC(Cl)=CCl)S(C)(=O)=O |
| InChI | InChI=1S/C9H18Cl2N2O2S/c1-3-13(16(2,14)15)6-4-5-12-8-9(11)7-10/h7,12H,3-6,8H2,1-2H3 |
| InChIKey | ALYUMVZXOPNPAZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|