C11H22Cl2N2 — CID 79167644
N-(2,3-dichloroprop-2-enyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 79167644) has the molecular formula C11H22Cl2N2 and a molecular weight of 253.22 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 79167644 |
| Molecular Formula | C11H22Cl2N2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(C)N(C)CCCCNCC(Cl)=CCl |
| InChI | InChI=1S/C11H22Cl2N2/c1-10(2)15(3)7-5-4-6-14-9-11(13)8-12/h8,10,14H,4-7,9H2,1-3H3 |
| InChIKey | BWBLUENAGXXNBF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|