C8H15Cl2N3O — CID 83120350
3-[2-(2,3-dichloroprop-2-enylamino)ethyl]-1,1-dimethylurea (PubChem CID 83120350) has the molecular formula C8H15Cl2N3O and a molecular weight of 240.13 g/mol. Its IUPAC name is 3-[2-(2,3-dichloroprop-2-enylamino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(2,3-dichloroprop-2-enylamino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83120350 |
| Molecular Formula | C8H15Cl2N3O |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-[2-(2,3-dichloroprop-2-enylamino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC(Cl)=CCl |
| InChI | InChI=1S/C8H15Cl2N3O/c1-13(2)8(14)12-4-3-11-6-7(10)5-9/h5,11H,3-4,6H2,1-2H3,(H,12,14) |
| InChIKey | FACZFFYPCNBAEE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|