C9H18ClN3O — CID 83121574
3-[2-[[(E)-4-chlorobut-2-enyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83121574) has the molecular formula C9H18ClN3O and a molecular weight of 219.72 g/mol. Its IUPAC name is 3-[2-[[(E)-4-chlorobut-2-enyl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[(E)-4-chlorobut-2-enyl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121574 |
| Molecular Formula | C9H18ClN3O |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-[2-[[(E)-4-chlorobut-2-enyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNC/C=C/CCl |
| InChI | InChI=1S/C9H18ClN3O/c1-13(2)9(14)12-8-7-11-6-4-3-5-10/h3-4,11H,5-8H2,1-2H3,(H,12,14)/b4-3+ |
| InChIKey | LFJBBFALYDMECT-ONEGZZNKSA-N |
| XLogP | 0.64 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|