C8H16N2 — CID 62311533
N-but-2-ynyl-N',N'-dimethylethane-1,2-diamine (PubChem CID 62311533) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is N-but-2-ynyl-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-but-2-ynyl-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62311533 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N-but-2-ynyl-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC#CCNCCN(C)C |
| InChI | InChI=1S/C8H16N2/c1-4-5-6-9-7-8-10(2)3/h9H,6-8H2,1-3H3 |
| InChIKey | LSMJQXHWWRWYMB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|