C10H22N2 — CID 107001471
N-[(2,2-dimethylcyclopropyl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 107001471) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N-[(2,2-dimethylcyclopropyl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(2,2-dimethylcyclopropyl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 107001471 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N-[(2,2-dimethylcyclopropyl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC1CC1(C)C |
| InChI | InChI=1S/C10H22N2/c1-10(2)7-9(10)8-11-5-6-12(3)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | ZDUUTNFFUXVVMG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|