About acetonitrile;N'-hydroxybutanimidamide
acetonitrile;N'-hydroxybutanimidamide (PubChem CID 159901217) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is acetonitrile;N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | acetonitrile;N'-hydroxybutanimidamide |
| PubChem CID | 159901217 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | acetonitrile;N'-hydroxybutanimidamide |
| SMILES | CC#N.CCCC(N)=NO |
| InChI | InChI=1S/C4H10N2O.C2H3N/c1-2-3-4(5)6-7;1-2-3/h7H,2-3H2,1H3,(H2,5,6);1H3 |
| InChIKey | NVZCZAMMFKVEOX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N'-hydroxybutanimidamide?
The IUPAC name of acetonitrile;N'-hydroxybutanimidamide (CID 159901217) is acetonitrile;N'-hydroxybutanimidamide.
What is the SMILES notation for acetonitrile;N'-hydroxybutanimidamide?
The canonical SMILES for acetonitrile;N'-hydroxybutanimidamide is CC#N.CCCC(N)=NO.
What is the InChIKey of acetonitrile;N'-hydroxybutanimidamide?
The InChIKey is NVZCZAMMFKVEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.C2H3N/c1-2-3-4(5)6-7;1-2-3/h7H,2-3H2,1H3,(H2,5,6);1H3.
What are the key properties of acetonitrile;N'-hydroxybutanimidamide?
acetonitrile;N'-hydroxybutanimidamide has a molecular weight of 143.19 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N'-hydroxybutanimidamide is sourced from PubChem (CID 159901217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).