About ethyl 2-cyanoacetate;propanedinitrile
ethyl 2-cyanoacetate;propanedinitrile (PubChem CID 175044548) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is ethyl 2-cyanoacetate;propanedinitrile.
Molecular Properties
| Compound Name | ethyl 2-cyanoacetate;propanedinitrile |
| PubChem CID | 175044548 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | ethyl 2-cyanoacetate;propanedinitrile |
| SMILES | CCOC(=O)CC#N.N#CCC#N |
| InChI | InChI=1S/C5H7NO2.C3H2N2/c1-2-8-5(7)3-4-6;4-2-1-3-5/h2-3H2,1H3;1H2 |
| InChIKey | CUSQHTLSMCJNKI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-cyanoacetate;propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyanoacetate;propanedinitrile?
The IUPAC name of ethyl 2-cyanoacetate;propanedinitrile (CID 175044548) is ethyl 2-cyanoacetate;propanedinitrile.
What is the SMILES notation for ethyl 2-cyanoacetate;propanedinitrile?
The canonical SMILES for ethyl 2-cyanoacetate;propanedinitrile is CCOC(=O)CC#N.N#CCC#N.
What is the InChIKey of ethyl 2-cyanoacetate;propanedinitrile?
The InChIKey is CUSQHTLSMCJNKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.C3H2N2/c1-2-8-5(7)3-4-6;4-2-1-3-5/h2-3H2,1H3;1H2.
What are the key properties of ethyl 2-cyanoacetate;propanedinitrile?
ethyl 2-cyanoacetate;propanedinitrile has a molecular weight of 179.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyanoacetate;propanedinitrile is sourced from PubChem (CID 175044548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).