About ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione
ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione (PubChem CID 134555767) has the molecular formula C10H14ClNO4S2
and a molecular weight of 311.81 g/mol. Its IUPAC name is ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione.
Molecular Properties
| Compound Name | ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione |
| PubChem CID | 134555767 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione |
| SMILES | CCOC(=O)CC#N.CCOC(=O)CCl.S=C=S |
| InChI | InChI=1S/C5H7NO2.C4H7ClO2.CS2/c1-2-8-5(7)3-4-6;1-2-7-4(6)3-5;2-1-3/h2-3H2,1H3;2-3H2,1H3; |
| InChIKey | UBJLUROXSWLMOO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione?
The IUPAC name of ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione (CID 134555767) is ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione.
What is the SMILES notation for ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione?
The canonical SMILES for ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione is CCOC(=O)CC#N.CCOC(=O)CCl.S=C=S.
What is the InChIKey of ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione?
The InChIKey is UBJLUROXSWLMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.C4H7ClO2.CS2/c1-2-8-5(7)3-4-6;1-2-7-4(6)3-5;2-1-3/h2-3H2,1H3;2-3H2,1H3;.
What are the key properties of ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione?
ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione has a molecular weight of 311.81 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chloroacetate;ethyl 2-cyanoacetate;methanedithione is sourced from PubChem (CID 134555767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).