About ethyl acetate;methanedithione
ethyl acetate;methanedithione (PubChem CID 88868108) has the molecular formula C5H8O2S2
and a molecular weight of 164.25 g/mol. Its IUPAC name is ethyl acetate;methanedithione.
Molecular Properties
| Compound Name | ethyl acetate;methanedithione |
| PubChem CID | 88868108 |
| Molecular Formula | C5H8O2S2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | ethyl acetate;methanedithione |
| SMILES | CCOC(C)=O.S=C=S |
| InChI | InChI=1S/C4H8O2.CS2/c1-3-6-4(2)5;2-1-3/h3H2,1-2H3; |
| InChIKey | IQJFLDLKFWMBGA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;methanedithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;methanedithione?
The IUPAC name of ethyl acetate;methanedithione (CID 88868108) is ethyl acetate;methanedithione.
What is the SMILES notation for ethyl acetate;methanedithione?
The canonical SMILES for ethyl acetate;methanedithione is CCOC(C)=O.S=C=S.
What is the InChIKey of ethyl acetate;methanedithione?
The InChIKey is IQJFLDLKFWMBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.CS2/c1-3-6-4(2)5;2-1-3/h3H2,1-2H3;.
What are the key properties of ethyl acetate;methanedithione?
ethyl acetate;methanedithione has a molecular weight of 164.25 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;methanedithione is sourced from PubChem (CID 88868108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).