C10H13NO — CID 175904429
3,7-dimethyl-5-oxoocta-3,6-dienenitrile (PubChem CID 175904429) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 3,7-dimethyl-5-oxoocta-3,6-dienenitrile.
| Compound Name | 3,7-dimethyl-5-oxoocta-3,6-dienenitrile |
|---|---|
| PubChem CID | 175904429 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3,7-dimethyl-5-oxoocta-3,6-dienenitrile |
| SMILES | CC(C)=CC(=O)C=C(C)CC#N |
| InChI | InChI=1S/C10H13NO/c1-8(2)6-10(12)7-9(3)4-5-11/h6-7H,4H2,1-3H3 |
| InChIKey | RBUJWWMNMCDSRF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|