C10H17ClO2 — CID 159580944
1-chloro-2,6-dimethylhepta-2,5-dien-4-one;methanol (PubChem CID 159580944) has the molecular formula C10H17ClO2 and a molecular weight of 204.70 g/mol. Its IUPAC name is 1-chloro-2,6-dimethylhepta-2,5-dien-4-one;methanol.
| Compound Name | 1-chloro-2,6-dimethylhepta-2,5-dien-4-one;methanol |
|---|---|
| PubChem CID | 159580944 |
| Molecular Formula | C10H17ClO2 |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-chloro-2,6-dimethylhepta-2,5-dien-4-one;methanol |
| SMILES | CC(C)=CC(=O)C=C(C)CCl.CO |
| InChI | InChI=1S/C9H13ClO.CH4O/c1-7(2)4-9(11)5-8(3)6-10;1-2/h4-5H,6H2,1-3H3;2H,1H3 |
| InChIKey | MIZUOORZFHMCMK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|