About butan-2-one;4-methylpent-3-en-2-one
butan-2-one;4-methylpent-3-en-2-one (PubChem CID 87594966) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is butan-2-one;4-methylpent-3-en-2-one.
Molecular Properties
| Compound Name | butan-2-one;4-methylpent-3-en-2-one |
| PubChem CID | 87594966 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | butan-2-one;4-methylpent-3-en-2-one |
| SMILES | CC(=O)C=C(C)C.CCC(C)=O |
| InChI | InChI=1S/C6H10O.C4H8O/c1-5(2)4-6(3)7;1-3-4(2)5/h4H,1-3H3;3H2,1-2H3 |
| InChIKey | QMDBMTVUCNJUAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;4-methylpent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;4-methylpent-3-en-2-one?
The IUPAC name of butan-2-one;4-methylpent-3-en-2-one (CID 87594966) is butan-2-one;4-methylpent-3-en-2-one.
What is the SMILES notation for butan-2-one;4-methylpent-3-en-2-one?
The canonical SMILES for butan-2-one;4-methylpent-3-en-2-one is CC(=O)C=C(C)C.CCC(C)=O.
What is the InChIKey of butan-2-one;4-methylpent-3-en-2-one?
The InChIKey is QMDBMTVUCNJUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C4H8O/c1-5(2)4-6(3)7;1-3-4(2)5/h4H,1-3H3;3H2,1-2H3.
What are the key properties of butan-2-one;4-methylpent-3-en-2-one?
butan-2-one;4-methylpent-3-en-2-one has a molecular weight of 170.25 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;4-methylpent-3-en-2-one is sourced from PubChem (CID 87594966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).