C15H22O2 — CID 162958275
(5E,7E,10R)-10-hydroxy-2,6,10-trimethyldodeca-2,5,7,11-tetraen-4-one (PubChem CID 162958275) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (5E,7E,10R)-10-hydroxy-2,6,10-trimethyldodeca-2,5,7,11-tetraen-4-one.
| Compound Name | (5E,7E,10R)-10-hydroxy-2,6,10-trimethyldodeca-2,5,7,11-tetraen-4-one |
|---|---|
| PubChem CID | 162958275 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (5E,7E,10R)-10-hydroxy-2,6,10-trimethyldodeca-2,5,7,11-tetraen-4-one |
| SMILES | C=C[C@](C)(O)C/C=C/C(C)=C/C(=O)C=C(C)C |
| InChI | InChI=1S/C15H22O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h6-8,10-11,17H,1,9H2,2-5H3/b8-7+,13-11+/t15-/m0/s1 |
| InChIKey | VJTLYZMVAHGVGD-HIJPRNNNSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|