C20H34O3 — CID 163127323
2,6,10,14-tetramethylhexadeca-2,6,11,15-tetraene-1,10,14-triol (PubChem CID 163127323) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2,6,10,14-tetramethylhexadeca-2,6,11,15-tetraene-1,10,14-triol.
| Compound Name | 2,6,10,14-tetramethylhexadeca-2,6,11,15-tetraene-1,10,14-triol |
|---|---|
| PubChem CID | 163127323 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2,6,10,14-tetramethylhexadeca-2,6,11,15-tetraene-1,10,14-triol |
| SMILES | C=CC(C)(O)CC=CC(C)(O)CCC=C(C)CCC=C(C)CO |
| InChI | InChI=1S/C20H34O3/c1-6-19(4,22)14-9-15-20(5,23)13-8-12-17(2)10-7-11-18(3)16-21/h6,9,11-12,15,21-23H,1,7-8,10,13-14,16H2,2-5H3 |
| InChIKey | DUZIISMRFRISNA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|