C6H8Cl2O — CID 5367734
(E)-1,5-dichloro-4-methylpent-3-en-2-one (PubChem CID 5367734) has the molecular formula C6H8Cl2O and a molecular weight of 167.03 g/mol. Its IUPAC name is (E)-1,5-dichloro-4-methylpent-3-en-2-one.
| Compound Name | (E)-1,5-dichloro-4-methylpent-3-en-2-one |
|---|---|
| PubChem CID | 5367734 |
| Molecular Formula | C6H8Cl2O |
| Molecular Weight | 167.03 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | (E)-1,5-dichloro-4-methylpent-3-en-2-one |
| SMILES | C/C(=C\C(=O)CCl)CCl |
| InChI | InChI=1S/C6H8Cl2O/c1-5(3-7)2-6(9)4-8/h2H,3-4H2,1H3/b5-2+ |
| InChIKey | DPGHQOBXNACMLW-GORDUTHDSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.03 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|