C4H3Cl3O — CID 12539069
1,4,4-Trichlorobut-3-en-2-one (PubChem CID 12539069) has the molecular formula C4H3Cl3O and a molecular weight of 173.42 g/mol. Its IUPAC name is 1,4,4-trichlorobut-3-en-2-one.
| Compound Name | 1,4,4-Trichlorobut-3-en-2-one |
|---|---|
| PubChem CID | 12539069 |
| Molecular Formula | C4H3Cl3O |
| Molecular Weight | 173.42 g/mol |
| Exact Mass | 171.92 |
| IUPAC Name | 1,4,4-trichlorobut-3-en-2-one |
| SMILES | C(C(=O)C=C(Cl)Cl)Cl |
| InChI | InChI=1S/C4H3Cl3O/c5-2-3(8)1-4(6)7/h1H,2H2 |
| InChIKey | CQUCSVSWHNTHNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | 114 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|