C8H12Cl2 — CID 102247621
(2Z)-1,3-dichloro-2,5-dimethylhexa-2,4-diene (PubChem CID 102247621) has the molecular formula C8H12Cl2 and a molecular weight of 179.09 g/mol. Its IUPAC name is (2Z)-1,3-dichloro-2,5-dimethylhexa-2,4-diene.
| Compound Name | (2Z)-1,3-dichloro-2,5-dimethylhexa-2,4-diene |
|---|---|
| PubChem CID | 102247621 |
| Molecular Formula | C8H12Cl2 |
| Molecular Weight | 179.09 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | (2Z)-1,3-dichloro-2,5-dimethylhexa-2,4-diene |
| SMILES | CC(C)=C/C(Cl)=C(\C)CCl |
| InChI | InChI=1S/C8H12Cl2/c1-6(2)4-8(10)7(3)5-9/h4H,5H2,1-3H3/b8-7- |
| InChIKey | YJYGSUOFRDOYHZ-FPLPWBNLSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.09 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|