C8H12ClF — CID 142966320
(4Z)-4-chloro-5-fluoro-2-methylhepta-2,4-diene (PubChem CID 142966320) has the molecular formula C8H12ClF and a molecular weight of 162.63 g/mol. Its IUPAC name is (4Z)-4-chloro-5-fluoro-2-methylhepta-2,4-diene.
| Compound Name | (4Z)-4-chloro-5-fluoro-2-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 142966320 |
| Molecular Formula | C8H12ClF |
| Molecular Weight | 162.63 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (4Z)-4-chloro-5-fluoro-2-methylhepta-2,4-diene |
| SMILES | CC/C(F)=C(/Cl)C=C(C)C |
| InChI | InChI=1S/C8H12ClF/c1-4-8(10)7(9)5-6(2)3/h5H,4H2,1-3H3/b8-7- |
| InChIKey | VEZLPJFUEOMOGH-FPLPWBNLSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|