C8H10Cl2 — CID 123471321
1,5-dichloro-3-ethylhexa-1,2,4-triene (PubChem CID 123471321) has the molecular formula C8H10Cl2 and a molecular weight of 177.07 g/mol. Its IUPAC name is 1,5-dichloro-3-ethylhexa-1,2,4-triene.
| Compound Name | 1,5-dichloro-3-ethylhexa-1,2,4-triene |
|---|---|
| PubChem CID | 123471321 |
| Molecular Formula | C8H10Cl2 |
| Molecular Weight | 177.07 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 1,5-dichloro-3-ethylhexa-1,2,4-triene |
| SMILES | CCC(=C=CCl)C=C(C)Cl |
| InChI | InChI=1S/C8H10Cl2/c1-3-8(4-5-9)6-7(2)10/h5-6H,3H2,1-2H3 |
| InChIKey | GKKBWNHYQMQLRT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.07 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|