C7H11ClS — CID 142053852
(3E)-4-chloro-2-ethylsulfanylpenta-1,3-diene (PubChem CID 142053852) has the molecular formula C7H11ClS and a molecular weight of 162.68 g/mol. Its IUPAC name is (3E)-4-chloro-2-ethylsulfanylpenta-1,3-diene.
| Compound Name | (3E)-4-chloro-2-ethylsulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 142053852 |
| Molecular Formula | C7H11ClS |
| Molecular Weight | 162.68 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | (3E)-4-chloro-2-ethylsulfanylpenta-1,3-diene |
| SMILES | C=C(/C=C(\C)Cl)SCC |
| InChI | InChI=1S/C7H11ClS/c1-4-9-7(3)5-6(2)8/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | ABWULUSIVIHLRD-AATRIKPKSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|