About 1-chloro-1,2-bis(ethylsulfanyl)ethene
1-chloro-1,2-bis(ethylsulfanyl)ethene (PubChem CID 86104745) has the molecular formula C6H11ClS2
and a molecular weight of 182.74 g/mol. Its IUPAC name is 1-chloro-1,2-bis(ethylsulfanyl)ethene.
Molecular Properties
| Compound Name | 1-chloro-1,2-bis(ethylsulfanyl)ethene |
| PubChem CID | 86104745 |
| Molecular Formula | C6H11ClS2 |
| Molecular Weight | 182.74 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 1-chloro-1,2-bis(ethylsulfanyl)ethene |
| SMILES | CCSC=C(Cl)SCC |
| InChI | InChI=1S/C6H11ClS2/c1-3-8-5-6(7)9-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | AQLBSHLUMQJJSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-1,2-bis(ethylsulfanyl)ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,2-bis(ethylsulfanyl)ethene?
The IUPAC name of 1-chloro-1,2-bis(ethylsulfanyl)ethene (CID 86104745) is 1-chloro-1,2-bis(ethylsulfanyl)ethene.
What is the SMILES notation for 1-chloro-1,2-bis(ethylsulfanyl)ethene?
The canonical SMILES for 1-chloro-1,2-bis(ethylsulfanyl)ethene is CCSC=C(Cl)SCC.
What is the InChIKey of 1-chloro-1,2-bis(ethylsulfanyl)ethene?
The InChIKey is AQLBSHLUMQJJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClS2/c1-3-8-5-6(7)9-4-2/h5H,3-4H2,1-2H3.
What are the key properties of 1-chloro-1,2-bis(ethylsulfanyl)ethene?
1-chloro-1,2-bis(ethylsulfanyl)ethene has a molecular weight of 182.74 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,2-bis(ethylsulfanyl)ethene is sourced from PubChem (CID 86104745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).