C11H17ClF3N — CID 170732020
(E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine;propane (PubChem CID 170732020) has the molecular formula C11H17ClF3N and a molecular weight of 255.71 g/mol. Its IUPAC name is (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine;propane.
| Compound Name | (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine;propane |
|---|---|
| PubChem CID | 170732020 |
| Molecular Formula | C11H17ClF3N |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (E)-4-chloro-1,1,1-trifluoro-N-prop-1-en-2-ylpent-3-en-2-imine;propane |
| SMILES | C=C(C)/N=C(/C=C(\C)Cl)C(F)(F)F.CCC |
| InChI | InChI=1S/C8H9ClF3N.C3H8/c1-5(2)13-7(4-6(3)9)8(10,11)12;1-3-2/h4H,1H2,2-3H3;3H2,1-2H3/b6-4+,13-7-; |
| InChIKey | PWJNGWGNQIHJIG-JTGNPJFOSA-N |
| XLogP | 5.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|