C10H14F3N — CID 162552052
3-methylidene-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine (PubChem CID 162552052) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-methylidene-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine.
| Compound Name | 3-methylidene-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 162552052 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-methylidene-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]pentan-2-imine |
| SMILES | C=C(CC)/C(C)=N/C(=C\C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-5-7(3)8(4)14-9(6-2)10(11,12)13/h6H,3,5H2,1-2,4H3/b9-6-,14-8+ |
| InChIKey | BTHGDULAVFEUTM-UVPTZGENSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|