C14H16F3NO — CID 172586709
[3-methyl-4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]methanol (PubChem CID 172586709) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is [3-methyl-4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]methanol.
| Compound Name | [3-methyl-4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]methanol |
|---|---|
| PubChem CID | 172586709 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [3-methyl-4-[C-methyl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]phenyl]methanol |
| SMILES | C/C=C(\N=C(/C)c1ccc(CO)cc1C)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO/c1-4-13(14(15,16)17)18-10(3)12-6-5-11(8-19)7-9(12)2/h4-7,19H,8H2,1-3H3/b13-4-,18-10+ |
| InChIKey | GSVOZSQTEFNPJQ-GXNAEANISA-N |
| XLogP | 3.76 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|