C16H19ClF3NO — CID 172586568
[4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-chlorophenyl]methanol (PubChem CID 172586568) has the molecular formula C16H19ClF3NO and a molecular weight of 333.78 g/mol. Its IUPAC name is [4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-chlorophenyl]methanol.
| Compound Name | [4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-chlorophenyl]methanol |
|---|---|
| PubChem CID | 172586568 |
| Molecular Formula | C16H19ClF3NO |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [4-[C-butan-2-yl-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]carbonimidoyl]-3-chlorophenyl]methanol |
| SMILES | C/C=C(\N=C(\c1ccc(CO)cc1Cl)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C16H19ClF3NO/c1-4-10(3)15(21-14(5-2)16(18,19)20)12-7-6-11(9-22)8-13(12)17/h5-8,10,22H,4,9H2,1-3H3/b14-5-,21-15+ |
| InChIKey | MRRIDQIJQPODCD-IYHYWARKSA-N |
| XLogP | 5.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|