C24H29F3 — CID 130284566
1-[(2Z)-hexa-2,5-dien-3-yl]-2-methyl-4-[(4Z,6E)-4-methyl-6-(trifluoromethyl)nona-4,6,8-trienyl]benzene (PubChem CID 130284566) has the molecular formula C24H29F3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[(2Z)-hexa-2,5-dien-3-yl]-2-methyl-4-[(4Z,6E)-4-methyl-6-(trifluoromethyl)nona-4,6,8-trienyl]benzene.
| Compound Name | 1-[(2Z)-hexa-2,5-dien-3-yl]-2-methyl-4-[(4Z,6E)-4-methyl-6-(trifluoromethyl)nona-4,6,8-trienyl]benzene |
|---|---|
| PubChem CID | 130284566 |
| Molecular Formula | C24H29F3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-[(2Z)-hexa-2,5-dien-3-yl]-2-methyl-4-[(4Z,6E)-4-methyl-6-(trifluoromethyl)nona-4,6,8-trienyl]benzene |
| SMILES | C=C/C=C(\C=C(\C)CCCc1ccc(/C(=C\C)CC=C)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3/c1-6-10-21(8-3)23-15-14-20(17-19(23)5)13-9-12-18(4)16-22(11-7-2)24(25,26)27/h6-8,11,14-17H,1-2,9-10,12-13H2,3-5H3/b18-16-,21-8-,22-11+ |
| InChIKey | CCOTWOOSEKQSAE-FQADXQJBSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|