C22H27NO — CID 130284145
(Z)-3-[4-[2-(2-ethyl-6-methyl-3-pyridinyl)ethyl]-2-methylphenyl]pent-3-enal (PubChem CID 130284145) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (Z)-3-[4-[2-(2-ethyl-6-methyl-3-pyridinyl)ethyl]-2-methylphenyl]pent-3-enal.
| Compound Name | (Z)-3-[4-[2-(2-ethyl-6-methyl-3-pyridinyl)ethyl]-2-methylphenyl]pent-3-enal |
|---|---|
| PubChem CID | 130284145 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (Z)-3-[4-[2-(2-ethyl-6-methyl-3-pyridinyl)ethyl]-2-methylphenyl]pent-3-enal |
| SMILES | C/C=C(/CC=O)c1ccc(CCc2ccc(C)nc2CC)cc1C |
| InChI | InChI=1S/C22H27NO/c1-5-19(13-14-24)21-12-9-18(15-16(21)3)8-11-20-10-7-17(4)23-22(20)6-2/h5,7,9-10,12,14-15H,6,8,11,13H2,1-4H3/b19-5- |
| InChIKey | NYVOROFEJNAOIB-IPKBDRFQSA-N |
| XLogP | 5.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|