C17H17NO4 — CID 174481865
4-[2-(4-amino-3-methylphenyl)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 174481865) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[2-(4-amino-3-methylphenyl)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-(4-amino-3-methylphenyl)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174481865 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[2-(4-amino-3-methylphenyl)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(CCc2ccc(C(=O)O)cc2C(=O)O)ccc1N |
| InChI | InChI=1S/C17H17NO4/c1-10-8-11(3-7-15(10)18)2-4-12-5-6-13(16(19)20)9-14(12)17(21)22/h3,5-9H,2,4,18H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | HOVAOPSHLLPXEX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|