C10H10O4S — CID 10130757
4-(2-sulfanylethyl)benzene-1,3-dicarboxylic acid (PubChem CID 10130757) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-(2-sulfanylethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(2-sulfanylethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 10130757 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-(2-sulfanylethyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(CCS)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H10O4S/c11-9(12)7-2-1-6(3-4-15)8(5-7)10(13)14/h1-2,5,15H,3-4H2,(H,11,12)(H,13,14) |
| InChIKey | CYWJBBPVDZBUAF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|