C13H16O6 — CID 139699705
4-[2-(2-hydroxypropoxy)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 139699705) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-[2-(2-hydroxypropoxy)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-(2-hydroxypropoxy)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 139699705 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-[2-(2-hydroxypropoxy)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(O)COCCc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C13H16O6/c1-8(14)7-19-5-4-9-2-3-10(12(15)16)6-11(9)13(17)18/h2-3,6,8,14H,4-5,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZYAPOOVWRGFWRH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|