C14H18O6 — CID 139699704
2-[2-(2-hydroxypropoxy)propyl]terephthalic acid (PubChem CID 139699704) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propyl]terephthalic acid.
| Compound Name | 2-[2-(2-hydroxypropoxy)propyl]terephthalic acid |
|---|---|
| PubChem CID | 139699704 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propyl]terephthalic acid |
| SMILES | CC(O)COC(C)Cc1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C14H18O6/c1-8(15)7-20-9(2)5-11-6-10(13(16)17)3-4-12(11)14(18)19/h3-4,6,8-9,15H,5,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ZZDQOYSXVCXRTG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |