C18H30O6 — CID 139698251
1-[2-[2-(2-hydroxyethyl)-4-[2-(2-hydroxypropoxy)ethoxy]phenyl]ethoxy]propan-2-ol (PubChem CID 139698251) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[2-[2-(2-hydroxyethyl)-4-[2-(2-hydroxypropoxy)ethoxy]phenyl]ethoxy]propan-2-ol.
| Compound Name | 1-[2-[2-(2-hydroxyethyl)-4-[2-(2-hydroxypropoxy)ethoxy]phenyl]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 139698251 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-[2-[2-(2-hydroxyethyl)-4-[2-(2-hydroxypropoxy)ethoxy]phenyl]ethoxy]propan-2-ol |
| SMILES | CC(O)COCCOc1ccc(CCOCC(C)O)c(CCO)c1 |
| InChI | InChI=1S/C18H30O6/c1-14(20)12-22-8-6-16-3-4-18(11-17(16)5-7-19)24-10-9-23-13-15(2)21/h3-4,11,14-15,19-21H,5-10,12-13H2,1-2H3 |
| InChIKey | LGZVOUWKKUVHIN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|