C16H26O6 — CID 139698254
1-[2-[3-(hydroxymethyl)-4-(2-hydroxypropoxymethyl)phenoxy]ethoxy]propan-2-ol (PubChem CID 139698254) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[2-[3-(hydroxymethyl)-4-(2-hydroxypropoxymethyl)phenoxy]ethoxy]propan-2-ol.
| Compound Name | 1-[2-[3-(hydroxymethyl)-4-(2-hydroxypropoxymethyl)phenoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 139698254 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[2-[3-(hydroxymethyl)-4-(2-hydroxypropoxymethyl)phenoxy]ethoxy]propan-2-ol |
| SMILES | CC(O)COCCOc1ccc(COCC(C)O)c(CO)c1 |
| InChI | InChI=1S/C16H26O6/c1-12(18)9-20-5-6-22-16-4-3-14(15(7-16)8-17)11-21-10-13(2)19/h3-4,7,12-13,17-19H,5-6,8-11H2,1-2H3 |
| InChIKey | UYNIZQRRPHMQRV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|