C16H25ClO3 — CID 106453976
1-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]-4-propoxybenzene (PubChem CID 106453976) has the molecular formula C16H25ClO3 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]-4-propoxybenzene.
| Compound Name | 1-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]-4-propoxybenzene |
|---|---|
| PubChem CID | 106453976 |
| Molecular Formula | C16H25ClO3 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(chloromethyl)-2-[2-(2-methylpropoxy)ethoxy]-4-propoxybenzene |
| SMILES | CCCOc1ccc(CCl)c(OCCOCC(C)C)c1 |
| InChI | InChI=1S/C16H25ClO3/c1-4-7-19-15-6-5-14(11-17)16(10-15)20-9-8-18-12-13(2)3/h5-6,10,13H,4,7-9,11-12H2,1-3H3 |
| InChIKey | AMFLPOIFWQQFTJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|