C16H22ClNO2 — CID 65252883
4-[2-(chloromethyl)-5-propoxyphenoxy]-2,2-dimethylbutanenitrile (PubChem CID 65252883) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 4-[2-(chloromethyl)-5-propoxyphenoxy]-2,2-dimethylbutanenitrile.
| Compound Name | 4-[2-(chloromethyl)-5-propoxyphenoxy]-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65252883 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[2-(chloromethyl)-5-propoxyphenoxy]-2,2-dimethylbutanenitrile |
| SMILES | CCCOc1ccc(CCl)c(OCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C16H22ClNO2/c1-4-8-19-14-6-5-13(11-17)15(10-14)20-9-7-16(2,3)12-18/h5-6,10H,4,7-9,11H2,1-3H3 |
| InChIKey | RKPFERKSHJJLFR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|