C14H18ClF3O3 — CID 61490328
1-(chloromethyl)-4-propoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 61490328) has the molecular formula C14H18ClF3O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is 1-(chloromethyl)-4-propoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 1-(chloromethyl)-4-propoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 61490328 |
| Molecular Formula | C14H18ClF3O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(chloromethyl)-4-propoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | CCCOc1ccc(CCl)c(OCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3O3/c1-2-5-20-12-4-3-11(9-15)13(8-12)21-7-6-19-10-14(16,17)18/h3-4,8H,2,5-7,9-10H2,1H3 |
| InChIKey | RNVNYMBNNUJXDX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|