C17H29NO2 — CID 63062146
N-[(2,4-dipropoxyphenyl)methyl]-2-methylpropan-2-amine (PubChem CID 63062146) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(2,4-dipropoxyphenyl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(2,4-dipropoxyphenyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63062146 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-[(2,4-dipropoxyphenyl)methyl]-2-methylpropan-2-amine |
| SMILES | CCCOc1ccc(CNC(C)(C)C)c(OCCC)c1 |
| InChI | InChI=1S/C17H29NO2/c1-6-10-19-15-9-8-14(13-18-17(3,4)5)16(12-15)20-11-7-2/h8-9,12,18H,6-7,10-11,13H2,1-5H3 |
| InChIKey | VFHVTJMORAXCFK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |