C16H27NO3 — CID 65176070
1-[2-(3-ethoxypropoxy)-4-propoxyphenyl]-N-methylmethanamine (PubChem CID 65176070) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-[2-(3-ethoxypropoxy)-4-propoxyphenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(3-ethoxypropoxy)-4-propoxyphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65176070 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-[2-(3-ethoxypropoxy)-4-propoxyphenyl]-N-methylmethanamine |
| SMILES | CCCOc1ccc(CNC)c(OCCCOCC)c1 |
| InChI | InChI=1S/C16H27NO3/c1-4-9-19-15-8-7-14(13-17-3)16(12-15)20-11-6-10-18-5-2/h7-8,12,17H,4-6,9-11,13H2,1-3H3 |
| InChIKey | YHTFUEMSHKDGEH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|