4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid

C11H14O7S — CID 174381547

IUPAC4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid
SMILESCCc1ccc(C(=O)O)cc1C(=O)O.CS(=O)(=O)O
InChIInChI=1S/C10H10O4.CH4O3S/c1-2-6-3-4-7(9(11)12)5-8(6)10(13)14;1-5(2,3)4/h3-5H,2H2,1H3,(H,11,12)(H,13,14);1H3,(H,2,3,4)
InChIKeyQUOCZFITKPONPP-UHFFFAOYSA-N
MW290.29 g/mol
LogP1.15
Rot. Bonds3

About 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid

4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid (PubChem CID 174381547) has the molecular formula C11H14O7S and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid.

Molecular Properties

Compound Name4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid
PubChem CID174381547
Molecular FormulaC11H14O7S
Molecular Weight290.29 g/mol
Exact Mass290.05
IUPAC Name4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid
SMILESCCc1ccc(C(=O)O)cc1C(=O)O.CS(=O)(=O)O
InChIInChI=1S/C10H10O4.CH4O3S/c1-2-6-3-4-7(9(11)12)5-8(6)10(13)14;1-5(2,3)4/h3-5H,2H2,1H3,(H,11,12)(H,13,14);1H3,(H,2,3,4)
InChIKeyQUOCZFITKPONPP-UHFFFAOYSA-N
XLogP1.15
TPSA128.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.29
LogP ≤ 51.15
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid?
The IUPAC name of 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid (CID 174381547) is 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid.
What is the SMILES notation for 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid?
The canonical SMILES for 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid is CCc1ccc(C(=O)O)cc1C(=O)O.CS(=O)(=O)O.
What is the InChIKey of 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid?
The InChIKey is QUOCZFITKPONPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4.CH4O3S/c1-2-6-3-4-7(9(11)12)5-8(6)10(13)14;1-5(2,3)4/h3-5H,2H2,1H3,(H,11,12)(H,13,14);1H3,(H,2,3,4).
What are the key properties of 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid?
4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid has a molecular weight of 290.29 g/mol, XLogP of 1.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzene-1,3-dicarboxylic acid;methanesulfonic acid is sourced from PubChem (CID 174381547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).