C21H17NO4 — CID 174367682
4-[(N-phenylanilino)methyl]benzene-1,3-dicarboxylic acid (PubChem CID 174367682) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[(N-phenylanilino)methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[(N-phenylanilino)methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174367682 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[(N-phenylanilino)methyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(CN(c2ccccc2)c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H17NO4/c23-20(24)15-11-12-16(19(13-15)21(25)26)14-22(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-13H,14H2,(H,23,24)(H,25,26) |
| InChIKey | CHMXENRMSNDCRR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |