C17H19ClN2O2 — CID 167773616
6-[[(4-chloro-3-methylphenyl)methylamino]methyl]-2-ethylpyridine-3-carboxylic acid (PubChem CID 167773616) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 6-[[(4-chloro-3-methylphenyl)methylamino]methyl]-2-ethylpyridine-3-carboxylic acid.
| Compound Name | 6-[[(4-chloro-3-methylphenyl)methylamino]methyl]-2-ethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167773616 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 6-[[(4-chloro-3-methylphenyl)methylamino]methyl]-2-ethylpyridine-3-carboxylic acid |
| SMILES | CCc1nc(CNCc2ccc(Cl)c(C)c2)ccc1C(=O)O |
| InChI | InChI=1S/C17H19ClN2O2/c1-3-16-14(17(21)22)6-5-13(20-16)10-19-9-12-4-7-15(18)11(2)8-12/h4-8,19H,3,9-10H2,1-2H3,(H,21,22) |
| InChIKey | JQDLERMLMOFOGI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |