C17H27F — CID 142360129
ethane;4-ethyl-1-[(1E)-1-fluorobuta-1,3-dienyl]-2-methylbenzene (PubChem CID 142360129) has the molecular formula C17H27F and a molecular weight of 250.40 g/mol. Its IUPAC name is ethane;4-ethyl-1-[(1E)-1-fluorobuta-1,3-dienyl]-2-methylbenzene.
| Compound Name | ethane;4-ethyl-1-[(1E)-1-fluorobuta-1,3-dienyl]-2-methylbenzene |
|---|---|
| PubChem CID | 142360129 |
| Molecular Formula | C17H27F |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | ethane;4-ethyl-1-[(1E)-1-fluorobuta-1,3-dienyl]-2-methylbenzene |
| SMILES | C=C/C=C(/F)c1ccc(CC)cc1C.CC.CC |
| InChI | InChI=1S/C13H15F.2C2H6/c1-4-6-13(14)12-8-7-11(5-2)9-10(12)3;2*1-2/h4,6-9H,1,5H2,2-3H3;2*1-2H3/b13-6+;; |
| InChIKey | MCJAZVPHCDJWRL-JNXPPIHMSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|