C25H46 — CID 170619616
(3Z)-4,6-dimethylhepta-1,3,5-triene;ethane;4-ethyl-1,2-dimethylbenzene (PubChem CID 170619616) has the molecular formula C25H46 and a molecular weight of 346.64 g/mol. Its IUPAC name is (3Z)-4,6-dimethylhepta-1,3,5-triene;ethane;4-ethyl-1,2-dimethylbenzene.
| Compound Name | (3Z)-4,6-dimethylhepta-1,3,5-triene;ethane;4-ethyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 170619616 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | (3Z)-4,6-dimethylhepta-1,3,5-triene;ethane;4-ethyl-1,2-dimethylbenzene |
| SMILES | C=C/C=C(/C)C=C(C)C.CC.CC.CC.CCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H14.C9H14.3C2H6/c1-4-10-6-5-8(2)9(3)7-10;1-5-6-9(4)7-8(2)3;3*1-2/h5-7H,4H2,1-3H3;5-7H,1H2,2-4H3;3*1-2H3/b;9-6-;;; |
| InChIKey | SHMLQOWFNSZBDD-CPCIAOLLSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|